C22H38O — CID 167489957
(3S,5S,8S,9S,10S,13R,14S,16R)-3-ethyl-10,13,16-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 167489957) has the molecular formula C22H38O and a molecular weight of 318.55 g/mol. Its IUPAC name is (3S,5S,8S,9S,10S,13R,14S,16R)-3-ethyl-10,13,16-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8S,9S,10S,13R,14S,16R)-3-ethyl-10,13,16-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 167489957 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | (3S,5S,8S,9S,10S,13R,14S,16R)-3-ethyl-10,13,16-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC[C@]1(O)CC[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4C[C@@H](C)C[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C22H38O/c1-5-22(23)11-10-21(4)16(14-22)6-7-17-18(21)8-9-20(3)13-15(2)12-19(17)20/h15-19,23H,5-14H2,1-4H3/t15-,16+,17-,18+,19+,20-,21+,22+/m1/s1 |
| InChIKey | GKILYFAHTKUDRE-VFFDHWOVSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |