C22H40N4O — CID 144966353
N,N'-diamino-N-[2-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-oxoethyl]methanimidamide (PubChem CID 144966353) has the molecular formula C22H40N4O and a molecular weight of 376.59 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-oxoethyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-oxoethyl]methanimidamide |
|---|---|
| PubChem CID | 144966353 |
| Molecular Formula | C22H40N4O |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | N,N'-diamino-N-[2-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-oxoethyl]methanimidamide |
| SMILES | CCCC1C(CC)CCC2C1CCC1(C)C(C(=O)CN(N)/C=N\N)CCC21 |
| InChI | InChI=1S/C22H40N4O/c1-4-6-16-15(5-2)7-8-18-17(16)11-12-22(3)19(18)9-10-20(22)21(27)13-26(24)14-25-23/h14-20H,4-13,23-24H2,1-3H3/b25-14- |
| InChIKey | DBNUJEFBRPEXJI-QFEZKATASA-N |
| XLogP | 3.93 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|