C25H44N2O — CID 144732787
1-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-piperazin-1-ylethanone (PubChem CID 144732787) has the molecular formula C25H44N2O and a molecular weight of 388.64 g/mol. Its IUPAC name is 1-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-piperazin-1-ylethanone.
| Compound Name | 1-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 144732787 |
| Molecular Formula | C25H44N2O |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.35 |
| IUPAC Name | 1-(7-ethyl-3a-methyl-6-propyl-1,2,3,4,5,5a,6,7,8,9,9a,9b-dodecahydrocyclopenta[a]naphthalen-3-yl)-2-piperazin-1-ylethanone |
| SMILES | CCCC1C(CC)CCC2C1CCC1(C)C(C(=O)CN3CCNCC3)CCC21 |
| InChI | InChI=1S/C25H44N2O/c1-4-6-19-18(5-2)7-8-21-20(19)11-12-25(3)22(21)9-10-23(25)24(28)17-27-15-13-26-14-16-27/h18-23,26H,4-17H2,1-3H3 |
| InChIKey | DZGYPGQPTBSTMF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |