C24H40B2N4O2 — CID 171096819
CID 171096819 (PubChem CID 171096819) has the molecular formula C24H40B2N4O2 and a molecular weight of 438.23 g/mol.
| Compound Name | CID 171096819 |
|---|---|
| PubChem CID | 171096819 |
| Molecular Formula | C24H40B2N4O2 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C(=O)C1CCC2C3CCC4CC(COC)CCC4C3CCC12C)N(N)/N=C(/C)N |
| InChI | InChI=1S/C24H40B2N4O2/c1-14(27)29-30(28)24(25,26)22(31)21-9-8-20-19-7-5-16-12-15(13-32-3)4-6-17(16)18(19)10-11-23(20,21)2/h15-21H,4-13,28H2,1-3H3,(H2,27,29) |
| InChIKey | JMHZCLSNUODKHH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|