C24H39B3N4O2 — CID 171096793
CID 171096793 (PubChem CID 171096793) has the molecular formula C24H39B3N4O2 and a molecular weight of 448.04 g/mol.
| Compound Name | CID 171096793 |
|---|---|
| PubChem CID | 171096793 |
| Molecular Formula | C24H39B3N4O2 |
| Molecular Weight | 448.04 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])/C(N)=N/N(N)CC(=O)C1CCC2C3CCC4CC(COC)CCC4C3CCC12C |
| InChI | InChI=1S/C24H39B3N4O2/c1-23-10-9-17-16-5-3-14(13-33-2)11-15(16)4-6-18(17)19(23)7-8-20(23)21(32)12-31(29)30-22(28)24(25,26)27/h14-20H,3-13,29H2,1-2H3,(H2,28,30) |
| InChIKey | POEHLGRZBZAWQD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.04 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|