C28H40ClFN2O — CID 145065191
2-(6-amino-3-chloro-2-fluoroanilino)-1-[(3S,8R,10S,13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 145065191) has the molecular formula C28H40ClFN2O and a molecular weight of 475.09 g/mol. Its IUPAC name is 2-(6-amino-3-chloro-2-fluoroanilino)-1-[(3S,8R,10S,13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 2-(6-amino-3-chloro-2-fluoroanilino)-1-[(3S,8R,10S,13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 145065191 |
| Molecular Formula | C28H40ClFN2O |
| Molecular Weight | 475.09 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 2-(6-amino-3-chloro-2-fluoroanilino)-1-[(3S,8R,10S,13S,17S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | C[C@H]1CC[C@@]2(C)C(CC[C@@H]3C2CC[C@@]2(C)C3CC[C@@H]2C(=O)CNc2c(N)ccc(Cl)c2F)C1 |
| InChI | InChI=1S/C28H40ClFN2O/c1-16-10-12-27(2)17(14-16)4-5-18-19-6-7-21(28(19,3)13-11-20(18)27)24(33)15-32-26-23(31)9-8-22(29)25(26)30/h8-9,16-21,32H,4-7,10-15,31H2,1-3H3/t16-,17?,18-,19?,20?,21+,27-,28-/m0/s1 |
| InChIKey | BYTORSQJJQPHEP-OKBVTIHDSA-N |
| XLogP | 7.34 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.09 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|