C26H50O2Si2 — CID 6431497
[(3S,5R,13S,17S)-17-ethyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 6431497) has the molecular formula C26H50O2Si2 and a molecular weight of 450.86 g/mol. Its IUPAC name is [(3S,5R,13S,17S)-17-ethyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(3S,5R,13S,17S)-17-ethyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 6431497 |
| Molecular Formula | C26H50O2Si2 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | [(3S,5R,13S,17S)-17-ethyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | CC[C@]1(O[Si](C)(C)C)CCC2C3CC[C@@H]4C[C@@H](O[Si](C)(C)C)CCC4C3CC[C@@]21C |
| InChI | InChI=1S/C26H50O2Si2/c1-9-26(28-30(6,7)8)17-15-24-23-12-10-19-18-20(27-29(3,4)5)11-13-21(19)22(23)14-16-25(24,26)2/h19-24H,9-18H2,1-8H3/t19-,20+,21?,22?,23?,24?,25+,26+/m1/s1 |
| InChIKey | ASVCLJYMXYOOEI-DWBSPPHZSA-N |
| XLogP | 7.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|