C26H46O2Si2 — CID 91745240
[(3S,5R,8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 91745240) has the molecular formula C26H46O2Si2 and a molecular weight of 446.82 g/mol. Its IUPAC name is [(3S,5R,8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [(3S,5R,8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91745240 |
| Molecular Formula | C26H46O2Si2 |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | [(3S,5R,8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-3-trimethylsilyloxy-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | C#C[C@]1(O[Si](C)(C)C)CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](O[Si](C)(C)C)CC[C@@H]4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C26H46O2Si2/c1-9-26(28-30(6,7)8)17-15-24-23-12-10-19-18-20(27-29(3,4)5)11-13-21(19)22(23)14-16-25(24,26)2/h1,19-24H,10-18H2,2-8H3/t19-,20+,21+,22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | OWKGCCNZDJOOTK-NSJBNYACSA-N |
| XLogP | 7.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|