C26H40O4 — CID 11732472
(3R,3aR,3bR,5aS,7S,9aS,9bS,11aS)-7-(methoxymethoxy)-9a,11a-dimethyl-3-(4-methylpent-1-ynyl)-3a,3b,4,5,5a,6,7,8,9,9b,10,11-dodecahydro-3H-naphtho[2,1-e][2]benzofuran-1-one (PubChem CID 11732472) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is (3R,3aR,3bR,5aS,7S,9aS,9bS,11aS)-7-(methoxymethoxy)-9a,11a-dimethyl-3-(4-methylpent-1-ynyl)-3a,3b,4,5,5a,6,7,8,9,9b,10,11-dodecahydro-3H-naphtho[2,1-e][2]benzofuran-1-one.
| Compound Name | (3R,3aR,3bR,5aS,7S,9aS,9bS,11aS)-7-(methoxymethoxy)-9a,11a-dimethyl-3-(4-methylpent-1-ynyl)-3a,3b,4,5,5a,6,7,8,9,9b,10,11-dodecahydro-3H-naphtho[2,1-e][2]benzofuran-1-one |
|---|---|
| PubChem CID | 11732472 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (3R,3aR,3bR,5aS,7S,9aS,9bS,11aS)-7-(methoxymethoxy)-9a,11a-dimethyl-3-(4-methylpent-1-ynyl)-3a,3b,4,5,5a,6,7,8,9,9b,10,11-dodecahydro-3H-naphtho[2,1-e][2]benzofuran-1-one |
| SMILES | COCO[C@H]1CC[C@@]2(C)[C@@H](CC[C@H]3[C@H]4[C@H](C#CCC(C)C)OC(=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H40O4/c1-17(2)7-6-8-22-23-20-10-9-18-15-19(29-16-28-5)11-13-25(18,3)21(20)12-14-26(23,4)24(27)30-22/h17-23H,7,9-16H2,1-5H3/t18-,19-,20+,21-,22-,23-,25-,26-/m0/s1 |
| InChIKey | SLXXMLOVQJXMHD-MSCMAPCGSA-N |
| XLogP | 5.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|