C27H44O3 — CID 140673061
(3R,5R,8R,9R,10R,13R)-3-(methoxymethoxy)-10,13-dimethyl-17-[2-(2-methylpropoxy)ethyl]-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 140673061) has the molecular formula C27H44O3 and a molecular weight of 416.65 g/mol. Its IUPAC name is (3R,5R,8R,9R,10R,13R)-3-(methoxymethoxy)-10,13-dimethyl-17-[2-(2-methylpropoxy)ethyl]-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R,5R,8R,9R,10R,13R)-3-(methoxymethoxy)-10,13-dimethyl-17-[2-(2-methylpropoxy)ethyl]-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 140673061 |
| Molecular Formula | C27H44O3 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.33 |
| IUPAC Name | (3R,5R,8R,9R,10R,13R)-3-(methoxymethoxy)-10,13-dimethyl-17-[2-(2-methylpropoxy)ethyl]-2,3,4,5,6,7,8,9,11,12-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | COCO[C@@H]1CC[C@]2(C)[C@H](CC[C@H]3C4=CC=C(CCOCC(C)C)[C@@]4(C)CC[C@H]32)C1 |
| InChI | InChI=1S/C27H44O3/c1-19(2)17-29-15-12-20-7-9-24-23-8-6-21-16-22(30-18-28-5)10-13-27(21,4)25(23)11-14-26(20,24)3/h7,9,19,21-23,25H,6,8,10-18H2,1-5H3/t21-,22-,23+,25-,26-,27-/m1/s1 |
| InChIKey | YOAZDLAPGIRMMI-WNXSSJJKSA-N |
| XLogP | 6.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|