C22H31NO3 — CID 121474135
(3R,8S,9S,10S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 121474135) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (3R,8S,9S,10S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (3R,8S,9S,10S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 121474135 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (3R,8S,9S,10S,13S,14S)-3-(methoxymethoxy)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | COCO[C@@H]1CC[C@@]2(C)C(CC[C@@H]3[C@@H]2C(=O)C[C@]2(C)C(C#N)=CC[C@@H]32)C1 |
| InChI | InChI=1S/C22H31NO3/c1-21-9-8-16(26-13-25-3)10-14(21)4-6-17-18-7-5-15(12-23)22(18,2)11-19(24)20(17)21/h5,14,16-18,20H,4,6-11,13H2,1-3H3/t14?,16-,17+,18+,20-,21+,22-/m1/s1 |
| InChIKey | VUNYIVWKECWKOQ-COBRKDJPSA-N |
| XLogP | 4.26 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|