C22H33F3O5S — CID 90397222
[(3S,4aR,6aR,7aS,10aR,11aR,11bR)-3-(methoxymethoxy)-7a,11b-dimethyl-2,3,4,4a,5,6,6a,7,10,10a,11,11a-dodecahydro-1H-cyclopenta[b]phenanthren-8-yl] trifluoromethanesulfonate (PubChem CID 90397222) has the molecular formula C22H33F3O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is [(3S,4aR,6aR,7aS,10aR,11aR,11bR)-3-(methoxymethoxy)-7a,11b-dimethyl-2,3,4,4a,5,6,6a,7,10,10a,11,11a-dodecahydro-1H-cyclopenta[b]phenanthren-8-yl] trifluoromethanesulfonate.
| Compound Name | [(3S,4aR,6aR,7aS,10aR,11aR,11bR)-3-(methoxymethoxy)-7a,11b-dimethyl-2,3,4,4a,5,6,6a,7,10,10a,11,11a-dodecahydro-1H-cyclopenta[b]phenanthren-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90397222 |
| Molecular Formula | C22H33F3O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | [(3S,4aR,6aR,7aS,10aR,11aR,11bR)-3-(methoxymethoxy)-7a,11b-dimethyl-2,3,4,4a,5,6,6a,7,10,10a,11,11a-dodecahydro-1H-cyclopenta[b]phenanthren-8-yl] trifluoromethanesulfonate |
| SMILES | COCO[C@H]1CC[C@]2(C)[C@H](CC[C@@H]3C[C@]4(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@H]4C[C@H]32)C1 |
| InChI | InChI=1S/C22H33F3O5S/c1-20-9-8-17(29-13-28-3)10-15(20)5-4-14-12-21(2)16(11-18(14)20)6-7-19(21)30-31(26,27)22(23,24)25/h7,14-18H,4-6,8-13H2,1-3H3/t14-,15-,16+,17+,18-,20-,21+/m1/s1 |
| InChIKey | METXIUPUZZLHSK-DBQIPHBASA-N |
| XLogP | 5.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|