C19H29F3O5S — CID 11845772
[(3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalen-1-yl] trifluoromethanesulfonate (PubChem CID 11845772) has the molecular formula C19H29F3O5S and a molecular weight of 426.50 g/mol. Its IUPAC name is [(3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11845772 |
| Molecular Formula | C19H29F3O5S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalen-1-yl] trifluoromethanesulfonate |
| SMILES | COCOCC[C@H]1CC[C@@H]2C[C@]3(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@H]3C[C@H]2C1 |
| InChI | InChI=1S/C19H29F3O5S/c1-18-11-14-4-3-13(7-8-26-12-25-2)9-15(14)10-16(18)5-6-17(18)27-28(23,24)19(20,21)22/h6,13-16H,3-5,7-12H2,1-2H3/t13-,14-,15-,16+,18+/m1/s1 |
| InChIKey | ZOAOHDDJDWTKQE-JLOCXQCDSA-N |
| XLogP | 4.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|