C20H29F3O3S — CID 19932518
(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) trifluoromethanesulfonate (PubChem CID 19932518) has the molecular formula C20H29F3O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is (10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) trifluoromethanesulfonate.
| Compound Name | (10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 19932518 |
| Molecular Formula | C20H29F3O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) trifluoromethanesulfonate |
| SMILES | CC12CCC3C(CCC4CCCCC43C)C1CC=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H29F3O3S/c1-18-11-4-3-5-13(18)6-7-14-15-8-9-17(19(15,2)12-10-16(14)18)26-27(24,25)20(21,22)23/h9,13-16H,3-8,10-12H2,1-2H3 |
| InChIKey | WQWPOYRSGWZHJX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|