C20H26F3NO4S — CID 86641189
[(3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-7-oxo-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-1-yl] trifluoromethanesulfonate (PubChem CID 86641189) has the molecular formula C20H26F3NO4S and a molecular weight of 433.49 g/mol. Its IUPAC name is [(3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-7-oxo-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-7-oxo-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 86641189 |
| Molecular Formula | C20H26F3NO4S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [(3aS,3bR,9aR,9bS,11aS)-5,9a,11a-trimethyl-7-oxo-3a,3b,4,8,9,9b,10,11-octahydro-3H-cyclopenta[i]phenanthridin-1-yl] trifluoromethanesulfonate |
| SMILES | CN1C[C@@H]2[C@H](CC[C@]3(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@@H]23)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C20H26F3NO4S/c1-18-8-6-12(25)10-16(18)24(3)11-13-14-4-5-17(19(14,2)9-7-15(13)18)28-29(26,27)20(21,22)23/h5,10,13-15H,4,6-9,11H2,1-3H3/t13-,14-,15-,18+,19-/m0/s1 |
| InChIKey | NXYKMOVZKJLYSX-QERJWTBHSA-N |
| XLogP | 3.99 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|