C20H25F6NO8S2 — CID 10817131
tert-butyl (4aS,6aS,9aS,9bS)-6a-methyl-3,7-bis(trifluoromethylsulfonyloxy)-4a,5,6,9,9a,9b-hexahydro-1H-cyclopenta[f]quinoline-4-carboxylate (PubChem CID 10817131) has the molecular formula C20H25F6NO8S2 and a molecular weight of 585.54 g/mol. Its IUPAC name is tert-butyl (4aS,6aS,9aS,9bS)-6a-methyl-3,7-bis(trifluoromethylsulfonyloxy)-4a,5,6,9,9a,9b-hexahydro-1H-cyclopenta[f]quinoline-4-carboxylate.
| Compound Name | tert-butyl (4aS,6aS,9aS,9bS)-6a-methyl-3,7-bis(trifluoromethylsulfonyloxy)-4a,5,6,9,9a,9b-hexahydro-1H-cyclopenta[f]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 10817131 |
| Molecular Formula | C20H25F6NO8S2 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 585.09 |
| IUPAC Name | tert-butyl (4aS,6aS,9aS,9bS)-6a-methyl-3,7-bis(trifluoromethylsulfonyloxy)-4a,5,6,9,9a,9b-hexahydro-1H-cyclopenta[f]quinoline-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(OS(=O)(=O)C(F)(F)F)=CC[C@@H]2[C@@H]1CC[C@]1(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@@H]21 |
| InChI | InChI=1S/C20H25F6NO8S2/c1-17(2,3)33-16(28)27-13-9-10-18(4)12(6-7-14(18)34-36(29,30)19(21,22)23)11(13)5-8-15(27)35-37(31,32)20(24,25)26/h7-8,11-13H,5-6,9-10H2,1-4H3/t11-,12-,13-,18-/m0/s1 |
| InChIKey | KEVFXLAVSUVFET-RSLFNQERSA-N |
| XLogP | 4.89 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|