C19H26F3NO4S — CID 56993881
[(3aS,3bR,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl] trifluoromethanesulfonate (PubChem CID 56993881) has the molecular formula C19H26F3NO4S and a molecular weight of 421.48 g/mol. Its IUPAC name is [(3aS,3bR,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3aS,3bR,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 56993881 |
| Molecular Formula | C19H26F3NO4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [(3aS,3bR,9aR,9bR,11aS)-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydroindeno[5,4-f]quinolin-1-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12CCC(=O)NC1CC[C@@H]1[C@H]2CC[C@]2(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@@H]12 |
| InChI | InChI=1S/C19H26F3NO4S/c1-17-10-8-16(24)23-14(17)5-3-11-12-4-6-15(18(12,2)9-7-13(11)17)27-28(25,26)19(20,21)22/h6,11-14H,3-5,7-10H2,1-2H3,(H,23,24)/t11-,12-,13+,14?,17+,18-/m0/s1 |
| InChIKey | WAMIJHSHUOAROK-MAHAIHFLSA-N |
| XLogP | 3.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|