C18H29N3O — CID 70117900
(3aS,3bR,5aR,9aR,9bS,11aS)-1-hydrazinylidene-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one (PubChem CID 70117900) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is (3aS,3bR,5aR,9aR,9bS,11aS)-1-hydrazinylidene-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bR,5aR,9aR,9bS,11aS)-1-hydrazinylidene-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 70117900 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | (3aS,3bR,5aR,9aR,9bS,11aS)-1-hydrazinylidene-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one |
| SMILES | C[C@]12CCC(=O)N[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=NN)CC[C@@H]12 |
| InChI | InChI=1S/C18H29N3O/c1-17-10-8-16(22)20-14(17)5-3-11-12-4-6-15(21-19)18(12,2)9-7-13(11)17/h11-14H,3-10,19H2,1-2H3,(H,20,22)/t11-,12-,13-,14+,17+,18-/m0/s1 |
| InChIKey | PMUIWWHNPUFJPA-BYYBLHGYSA-N |
| XLogP | 2.82 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|