C25H34N2O — CID 67875226
(3aS,3bS,5aR,9aR,9bS,11aS)-1-[(4-aminophenyl)methylidene]-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one (PubChem CID 67875226) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is (3aS,3bS,5aR,9aR,9bS,11aS)-1-[(4-aminophenyl)methylidene]-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,5aR,9aR,9bS,11aS)-1-[(4-aminophenyl)methylidene]-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 67875226 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (3aS,3bS,5aR,9aR,9bS,11aS)-1-[(4-aminophenyl)methylidene]-9a,11a-dimethyl-3,3a,3b,4,5,5a,6,8,9,9b,10,11-dodecahydro-2H-indeno[5,4-f]quinolin-7-one |
| SMILES | C[C@]12CCC(=O)N[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=Cc3ccc(N)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H34N2O/c1-24-13-11-21-19(8-10-22-25(21,2)14-12-23(28)27-22)20(24)9-5-17(24)15-16-3-6-18(26)7-4-16/h3-4,6-7,15,19-22H,5,8-14,26H2,1-2H3,(H,27,28)/t19-,20-,21-,22+,24+,25+/m0/s1 |
| InChIKey | RAEYCADCNJUQRB-JKNIEJROSA-N |
| XLogP | 5.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|