C24H39NO2 — CID 15485983
(tert-butylamino) (8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 15485983) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is (tert-butylamino) (8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | (tert-butylamino) (8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 15485983 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | (tert-butylamino) (8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC(C)(C)NOC(=O)C1=CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H39NO2/c1-22(2,3)25-27-21(26)20-12-11-18-17-10-9-16-8-6-7-14-23(16,4)19(17)13-15-24(18,20)5/h12,16-19,25H,6-11,13-15H2,1-5H3/t16?,17-,18-,19-,23-,24-/m0/s1 |
| InChIKey | WTWXZTSDQDCITC-ADUXBZJESA-N |
| XLogP | 5.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|