C19H29NO2 — CID 11846146
(3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalene-1-carbonitrile (PubChem CID 11846146) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalene-1-carbonitrile.
| Compound Name | (3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 11846146 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (3aR,4aR,6S,8aR,9aS)-6-[2-(methoxymethoxy)ethyl]-9a-methyl-3,3a,4,4a,5,6,7,8,8a,9-decahydrocyclopenta[b]naphthalene-1-carbonitrile |
| SMILES | COCOCC[C@H]1CC[C@@H]2C[C@]3(C)C(C#N)=CC[C@H]3C[C@H]2C1 |
| InChI | InChI=1S/C19H29NO2/c1-19-11-15-4-3-14(7-8-22-13-21-2)9-16(15)10-17(19)5-6-18(19)12-20/h6,14-17H,3-5,7-11,13H2,1-2H3/t14-,15-,16-,17+,19+/m1/s1 |
| InChIKey | SGCOFZZYGKEPDG-RXYDEIHYSA-N |
| XLogP | 4.30 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|