C29H47F3O4S — CID 158756842
4-(4,4-dimethylcyclohexyl)cyclohexan-1-one;[4-(4,4-dimethylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 158756842) has the molecular formula C29H47F3O4S and a molecular weight of 548.75 g/mol. Its IUPAC name is 4-(4,4-dimethylcyclohexyl)cyclohexan-1-one;[4-(4,4-dimethylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | 4-(4,4-dimethylcyclohexyl)cyclohexan-1-one;[4-(4,4-dimethylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158756842 |
| Molecular Formula | C29H47F3O4S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 4-(4,4-dimethylcyclohexyl)cyclohexan-1-one;[4-(4,4-dimethylcyclohexyl)cyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)CCC(C2CC=C(OS(=O)(=O)C(F)(F)F)CC2)CC1.CC1(C)CCC(C2CCC(=O)CC2)CC1 |
| InChI | InChI=1S/C15H23F3O3S.C14H24O/c1-14(2)9-7-12(8-10-14)11-3-5-13(6-4-11)21-22(19,20)15(16,17)18;1-14(2)9-7-12(8-10-14)11-3-5-13(15)6-4-11/h5,11-12H,3-4,6-10H2,1-2H3;11-12H,3-10H2,1-2H3 |
| InChIKey | IOEHCYUEXKKRBX-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|