C10H15F3O4S — CID 139451508
[4-(methoxymethyl)-4-methylcyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 139451508) has the molecular formula C10H15F3O4S and a molecular weight of 288.29 g/mol. Its IUPAC name is [4-(methoxymethyl)-4-methylcyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [4-(methoxymethyl)-4-methylcyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139451508 |
| Molecular Formula | C10H15F3O4S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | [4-(methoxymethyl)-4-methylcyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | COCC1(C)CC=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H15F3O4S/c1-9(7-16-2)5-3-8(4-6-9)17-18(14,15)10(11,12)13/h3H,4-7H2,1-2H3 |
| InChIKey | LLMWRTPYSNHIGW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|