C9H11F3O3PdS — CID 173368820
cycloocta-1,5-dien-1-yl trifluoromethanesulfonate;palladium (PubChem CID 173368820) has the molecular formula C9H11F3O3PdS and a molecular weight of 362.67 g/mol. Its IUPAC name is cycloocta-1,5-dien-1-yl trifluoromethanesulfonate;palladium.
| Compound Name | cycloocta-1,5-dien-1-yl trifluoromethanesulfonate;palladium |
|---|---|
| PubChem CID | 173368820 |
| Molecular Formula | C9H11F3O3PdS |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 361.94 |
| IUPAC Name | cycloocta-1,5-dien-1-yl trifluoromethanesulfonate;palladium |
| SMILES | O=S(=O)(OC1=CCCC=CCC1)C(F)(F)F.[Pd] |
| InChI | InChI=1S/C9H11F3O3S.Pd/c10-9(11,12)16(13,14)15-8-6-4-2-1-3-5-7-8;/h1-2,7H,3-6H2; |
| InChIKey | APVQOSYRHPJWMR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|