C7H11BF3NO4S — CID 23525690
methyl-[4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-1-yl]borinic acid (PubChem CID 23525690) has the molecular formula C7H11BF3NO4S and a molecular weight of 273.04 g/mol. Its IUPAC name is methyl-[4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-1-yl]borinic acid.
| Compound Name | methyl-[4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-1-yl]borinic acid |
|---|---|
| PubChem CID | 23525690 |
| Molecular Formula | C7H11BF3NO4S |
| Molecular Weight | 273.04 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | methyl-[4-(trifluoromethylsulfonyloxy)-3,6-dihydro-2H-pyridin-1-yl]borinic acid |
| SMILES | CB(O)N1CC=C(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H11BF3NO4S/c1-8(13)12-4-2-6(3-5-12)16-17(14,15)7(9,10)11/h2,13H,3-5H2,1H3 |
| InChIKey | FCSDUXUBXMOMOS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.04 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|