C25H43BF3N3O6S — CID 159909322
(1-methyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate;1-methylpiperidin-4-one;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 159909322) has the molecular formula C25H43BF3N3O6S and a molecular weight of 581.51 g/mol. Its IUPAC name is (1-methyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate;1-methylpiperidin-4-one;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | (1-methyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate;1-methylpiperidin-4-one;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 159909322 |
| Molecular Formula | C25H43BF3N3O6S |
| Molecular Weight | 581.51 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | (1-methyl-3,6-dihydro-2H-pyridin-4-yl) trifluoromethanesulfonate;1-methylpiperidin-4-one;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CN1CC=C(B2OC(C)(C)C(C)(C)O2)CC1.CN1CC=C(OS(=O)(=O)C(F)(F)F)CC1.CN1CCC(=O)CC1 |
| InChI | InChI=1S/C12H22BNO2.C7H10F3NO3S.C6H11NO/c1-11(2)12(3,4)16-13(15-11)10-6-8-14(5)9-7-10;1-11-4-2-6(3-5-11)14-15(12,13)7(8,9)10;1-7-4-2-6(8)3-5-7/h6H,7-9H2,1-5H3;2H,3-5H2,1H3;2-5H2,1H3 |
| InChIKey | NWZDFCVCFCHUAL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|