About CID 158324901
CID 158324901 (PubChem CID 158324901) has the molecular formula C25H37B4F3N3O9S
and a molecular weight of 655.89 g/mol.
Molecular Properties
| Compound Name | CID 158324901 |
| PubChem CID | 158324901 |
| Molecular Formula | C25H37B4F3N3O9S |
| Molecular Weight | 655.89 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(C2=CN([B]C=O)CCC2)OC1(C)C.O=C[B]N1C=C(OS(=O)(=O)C(F)(F)F)CCC1.O=C[B]N1CCCC(=O)C1 |
| InChI | InChI=1S/C12H20B2NO3.C7H8BF3NO4S.C6H9BNO2/c1-11(2)12(3,4)18-14(17-11)10-6-5-7-15(8-10)13-9-16;9-7(10,11)17(14,15)16-6-2-1-3-12(4-6)8-5-13;9-5-7-8-3-1-2-6(10)4-8/h8-9H,5-7H2,1-4H3;4-5H,1-3H2;5H,1-4H2 |
| InChIKey | BRWDGDOVSJWTRX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 139.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 655.89 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 158324901 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158324901?
The IUPAC name of CID 158324901 (CID 158324901) is not available.
What is the SMILES notation for CID 158324901?
The canonical SMILES for CID 158324901 is CC1(C)OB(C2=CN([B]C=O)CCC2)OC1(C)C.O=C[B]N1C=C(OS(=O)(=O)C(F)(F)F)CCC1.O=C[B]N1CCCC(=O)C1.
What is the InChIKey of CID 158324901?
The InChIKey is BRWDGDOVSJWTRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20B2NO3.C7H8BF3NO4S.C6H9BNO2/c1-11(2)12(3,4)18-14(17-11)10-6-5-7-15(8-10)13-9-16;9-7(10,11)17(14,15)16-6-2-1-3-12(4-6)8-5-13;9-5-7-8-3-1-2-6(10)4-8/h8-9H,5-7H2,1-4H3;4-5H,1-3H2;5H,1-4H2.
What are the key properties of CID 158324901?
CID 158324901 has a molecular weight of 655.89 g/mol, XLogP of 1.47, 9 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158324901 is sourced from PubChem (CID 158324901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).