C25H37B4F3N3O9S — CID 158324901
CID 158324901 (PubChem CID 158324901) has the molecular formula C25H37B4F3N3O9S and a molecular weight of 655.89 g/mol.
| Compound Name | CID 158324901 |
|---|---|
| PubChem CID | 158324901 |
| Molecular Formula | C25H37B4F3N3O9S |
| Molecular Weight | 655.89 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | — |
| SMILES | CC1(C)OB(C2=CN([B]C=O)CCC2)OC1(C)C.O=C[B]N1C=C(OS(=O)(=O)C(F)(F)F)CCC1.O=C[B]N1CCCC(=O)C1 |
| InChI | InChI=1S/C12H20B2NO3.C7H8BF3NO4S.C6H9BNO2/c1-11(2)12(3,4)18-14(17-11)10-6-5-7-15(8-10)13-9-16;9-7(10,11)17(14,15)16-6-2-1-3-12(4-6)8-5-13;9-5-7-8-3-1-2-6(10)4-8/h8-9H,5-7H2,1-4H3;4-5H,1-3H2;5H,1-4H2 |
| InChIKey | BRWDGDOVSJWTRX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 139.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.89 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|