C14H17BBrF3O5S — CID 102412465
[2-bromo-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 102412465) has the molecular formula C14H17BBrF3O5S and a molecular weight of 445.06 g/mol. Its IUPAC name is [2-bromo-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-bromo-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102412465 |
| Molecular Formula | C14H17BBrF3O5S |
| Molecular Weight | 445.06 g/mol |
| Exact Mass | 444.00 |
| IUPAC Name | [2-bromo-4-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(Br)c(OS(=O)(=O)C(F)(F)F)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C14H17BBrF3O5S/c1-8-6-9(15-23-12(2,3)13(4,5)24-15)11(10(16)7-8)22-25(20,21)14(17,18)19/h6-7H,1-5H3 |
| InChIKey | BOIKDBQESXSLNZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.06 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|