C14H7Br2F3O4S — CID 162473505
(4,9-dibromo-7-methyldibenzofuran-2-yl) trifluoromethanesulfonate (PubChem CID 162473505) has the molecular formula C14H7Br2F3O4S and a molecular weight of 488.08 g/mol. Its IUPAC name is (4,9-dibromo-7-methyldibenzofuran-2-yl) trifluoromethanesulfonate.
| Compound Name | (4,9-dibromo-7-methyldibenzofuran-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162473505 |
| Molecular Formula | C14H7Br2F3O4S |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 485.84 |
| IUPAC Name | (4,9-dibromo-7-methyldibenzofuran-2-yl) trifluoromethanesulfonate |
| SMILES | Cc1cc(Br)c2c(c1)oc1c(Br)cc(OS(=O)(=O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C14H7Br2F3O4S/c1-6-2-9(15)12-8-4-7(23-24(20,21)14(17,18)19)5-10(16)13(8)22-11(12)3-6/h2-5H,1H3 |
| InChIKey | LNJIONXVJZYDOG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|