C11H8BrF9O8S3 — CID 161390368
(4-bromo-3,5-dimethylphenyl) trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 161390368) has the molecular formula C11H8BrF9O8S3 and a molecular weight of 615.26 g/mol. Its IUPAC name is (4-bromo-3,5-dimethylphenyl) trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | (4-bromo-3,5-dimethylphenyl) trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 161390368 |
| Molecular Formula | C11H8BrF9O8S3 |
| Molecular Weight | 615.26 g/mol |
| Exact Mass | 613.84 |
| IUPAC Name | (4-bromo-3,5-dimethylphenyl) trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(C)c1Br.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF3O3S.C2F6O5S2/c1-5-3-7(4-6(2)8(5)10)16-17(14,15)9(11,12)13;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h3-4H,1-2H3; |
| InChIKey | VSXHMWIGGWNUSD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|