C24H13Br4F9O10S3 — CID 159303237
(3,7-dibromo-6-methylnaphthalen-2-yl) trifluoromethanesulfonate;3,7-dibromonaphthalene-2,6-diol;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 159303237) has the molecular formula C24H13Br4F9O10S3 and a molecular weight of 1048.16 g/mol. Its IUPAC name is (3,7-dibromo-6-methylnaphthalen-2-yl) trifluoromethanesulfonate;3,7-dibromonaphthalene-2,6-diol;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | (3,7-dibromo-6-methylnaphthalen-2-yl) trifluoromethanesulfonate;3,7-dibromonaphthalene-2,6-diol;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 159303237 |
| Molecular Formula | C24H13Br4F9O10S3 |
| Molecular Weight | 1048.16 g/mol |
| Exact Mass | 1043.63 |
| IUPAC Name | (3,7-dibromo-6-methylnaphthalen-2-yl) trifluoromethanesulfonate;3,7-dibromonaphthalene-2,6-diol;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | Cc1cc2cc(Br)c(OS(=O)(=O)C(F)(F)F)cc2cc1Br.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.Oc1cc2cc(Br)c(O)cc2cc1Br |
| InChI | InChI=1S/C12H7Br2F3O3S.C10H6Br2O2.C2F6O5S2/c1-6-2-7-4-10(14)11(5-8(7)3-9(6)13)20-21(18,19)12(15,16)17;11-7-1-5-3-10(14)8(12)2-6(5)4-9(7)13;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h2-5H,1H3;1-4,13-14H; |
| InChIKey | LBPCADVKGAWENN-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.16 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|