C11H13BrF3NO5S — CID 168594883
[4-bromo-2-(2,3-dihydroxypropylamino)-5-methylphenyl] trifluoromethanesulfonate (PubChem CID 168594883) has the molecular formula C11H13BrF3NO5S and a molecular weight of 408.19 g/mol. Its IUPAC name is [4-bromo-2-(2,3-dihydroxypropylamino)-5-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-bromo-2-(2,3-dihydroxypropylamino)-5-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 168594883 |
| Molecular Formula | C11H13BrF3NO5S |
| Molecular Weight | 408.19 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | [4-bromo-2-(2,3-dihydroxypropylamino)-5-methylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)c(NCC(O)CO)cc1Br |
| InChI | InChI=1S/C11H13BrF3NO5S/c1-6-2-10(21-22(19,20)11(13,14)15)9(3-8(6)12)16-4-7(18)5-17/h2-3,7,16-18H,4-5H2,1H3 |
| InChIKey | NVYUXVRHWQJPOR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.19 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|