C8H5BrF3IO4S — CID 177474316
(5-bromo-2-iodo-3-methoxyphenyl) trifluoromethanesulfonate (PubChem CID 177474316) has the molecular formula C8H5BrF3IO4S and a molecular weight of 460.99 g/mol. Its IUPAC name is (5-bromo-2-iodo-3-methoxyphenyl) trifluoromethanesulfonate.
| Compound Name | (5-bromo-2-iodo-3-methoxyphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 177474316 |
| Molecular Formula | C8H5BrF3IO4S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 459.81 |
| IUPAC Name | (5-bromo-2-iodo-3-methoxyphenyl) trifluoromethanesulfonate |
| SMILES | COc1cc(Br)cc(OS(=O)(=O)C(F)(F)F)c1I |
| InChI | InChI=1S/C8H5BrF3IO4S/c1-16-5-2-4(9)3-6(7(5)13)17-18(14,15)8(10,11)12/h2-3H,1H3 |
| InChIKey | HWRDBOYHXNLSSP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|