C18H12F6O6S4 — CID 71486364
[3,7-bis(methylsulfanyl)-6-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate (PubChem CID 71486364) has the molecular formula C18H12F6O6S4 and a molecular weight of 566.54 g/mol. Its IUPAC name is [3,7-bis(methylsulfanyl)-6-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3,7-bis(methylsulfanyl)-6-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71486364 |
| Molecular Formula | C18H12F6O6S4 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | [3,7-bis(methylsulfanyl)-6-(trifluoromethylsulfonyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| SMILES | CSc1cc2cc3cc(OS(=O)(=O)C(F)(F)F)c(SC)cc3cc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H12F6O6S4/c1-31-15-7-11-3-10-6-14(30-34(27,28)18(22,23)24)16(32-2)8-12(10)4-9(11)5-13(15)29-33(25,26)17(19,20)21/h3-8H,1-2H3 |
| InChIKey | DYVMRNAFEZVYTB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|