C12H14F3NO4S — CID 139821338
(2-amino-3,3,7-trimethyl-2H-1-benzofuran-5-yl) trifluoromethanesulfonate (PubChem CID 139821338) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is (2-amino-3,3,7-trimethyl-2H-1-benzofuran-5-yl) trifluoromethanesulfonate.
| Compound Name | (2-amino-3,3,7-trimethyl-2H-1-benzofuran-5-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139821338 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (2-amino-3,3,7-trimethyl-2H-1-benzofuran-5-yl) trifluoromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc2c1OC(N)C2(C)C |
| InChI | InChI=1S/C12H14F3NO4S/c1-6-4-7(20-21(17,18)12(13,14)15)5-8-9(6)19-10(16)11(8,2)3/h4-5,10H,16H2,1-3H3 |
| InChIKey | PXVKMSCSPZUSNR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|