About (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate
(1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate (PubChem CID 165112761) has the molecular formula C18H17F3O5S
and a molecular weight of 402.39 g/mol. Its IUPAC name is (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate |
| PubChem CID | 165112761 |
| Molecular Formula | C18H17F3O5S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)cc2c1-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C18H17F3O5S/c1-10-5-6-13-12(7-10)16-14(24-4)8-11(9-15(16)25-17(13,2)3)26-27(22,23)18(19,20)21/h5-9H,1-4H3 |
| InChIKey | YBBRJQRALNRWHO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate?
The IUPAC name of (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate (CID 165112761) is (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate.
What is the SMILES notation for (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate?
The canonical SMILES for (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate is COc1cc(OS(=O)(=O)C(F)(F)F)cc2c1-c1cc(C)ccc1C(C)(C)O2.
What is the InChIKey of (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate?
The InChIKey is YBBRJQRALNRWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F3O5S/c1-10-5-6-13-12(7-10)16-14(24-4)8-11(9-15(16)25-17(13,2)3)26-27(22,23)18(19,20)21/h5-9H,1-4H3.
What are the key properties of (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate?
(1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate has a molecular weight of 402.39 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate is sourced from PubChem (CID 165112761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).