C18H17F3O5S — CID 165112761
(1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate (PubChem CID 165112761) has the molecular formula C18H17F3O5S and a molecular weight of 402.39 g/mol. Its IUPAC name is (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate.
| Compound Name | (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165112761 |
| Molecular Formula | C18H17F3O5S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (1-methoxy-6,6,9-trimethylbenzo[c]chromen-3-yl) trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)cc2c1-c1cc(C)ccc1C(C)(C)O2 |
| InChI | InChI=1S/C18H17F3O5S/c1-10-5-6-13-12(7-10)16-14(24-4)8-11(9-15(16)25-17(13,2)3)26-27(22,23)18(19,20)21/h5-9H,1-4H3 |
| InChIKey | YBBRJQRALNRWHO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|