C25H24O3 — CID 165112766
3-[(E)-2-(4-methoxyphenyl)ethenyl]-6,6,9-trimethylbenzo[c]chromen-1-ol (PubChem CID 165112766) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is 3-[(E)-2-(4-methoxyphenyl)ethenyl]-6,6,9-trimethylbenzo[c]chromen-1-ol.
| Compound Name | 3-[(E)-2-(4-methoxyphenyl)ethenyl]-6,6,9-trimethylbenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 165112766 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 3-[(E)-2-(4-methoxyphenyl)ethenyl]-6,6,9-trimethylbenzo[c]chromen-1-ol |
| SMILES | COc1ccc(/C=C/c2cc(O)c3c(c2)OC(C)(C)c2ccc(C)cc2-3)cc1 |
| InChI | InChI=1S/C25H24O3/c1-16-5-12-21-20(13-16)24-22(26)14-18(15-23(24)28-25(21,2)3)7-6-17-8-10-19(27-4)11-9-17/h5-15,26H,1-4H3/b7-6+ |
| InChIKey | WRSOONJCZYOAGS-VOTSOKGWSA-N |
| XLogP | 6.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|