C20H18F3NO3S — CID 175980704
[2-[2-(dimethylamino)naphthalen-1-yl]-4-methylphenyl] trifluoromethanesulfonate (PubChem CID 175980704) has the molecular formula C20H18F3NO3S and a molecular weight of 409.43 g/mol. Its IUPAC name is [2-[2-(dimethylamino)naphthalen-1-yl]-4-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [2-[2-(dimethylamino)naphthalen-1-yl]-4-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 175980704 |
| Molecular Formula | C20H18F3NO3S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | [2-[2-(dimethylamino)naphthalen-1-yl]-4-methylphenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)C(F)(F)F)c(-c2c(N(C)C)ccc3ccccc23)c1 |
| InChI | InChI=1S/C20H18F3NO3S/c1-13-8-11-18(27-28(25,26)20(21,22)23)16(12-13)19-15-7-5-4-6-14(15)9-10-17(19)24(2)3/h4-12H,1-3H3 |
| InChIKey | HNEXCNFXNNBMCB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|