C36H21F3O3S — CID 166048437
[1-(9,9'-spirobi[fluorene]-2-yl)naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 166048437) has the molecular formula C36H21F3O3S and a molecular weight of 590.62 g/mol. Its IUPAC name is [1-(9,9'-spirobi[fluorene]-2-yl)naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-(9,9'-spirobi[fluorene]-2-yl)naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166048437 |
| Molecular Formula | C36H21F3O3S |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.12 |
| IUPAC Name | [1-(9,9'-spirobi[fluorene]-2-yl)naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2ccccc2c1-c1ccc2c(c1)C1(c3ccccc3-c3ccccc31)c1ccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C36H21F3O3S/c37-36(38,39)43(40,41)42-33-20-18-22-9-1-2-10-24(22)34(33)23-17-19-28-27-13-5-8-16-31(27)35(32(28)21-23)29-14-6-3-11-25(29)26-12-4-7-15-30(26)35/h1-21H |
| InChIKey | QIOOIWLQYBSOMJ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|