C12H12F3NO4S — CID 10829731
(2,2,7-trimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate (PubChem CID 10829731) has the molecular formula C12H12F3NO4S and a molecular weight of 323.29 g/mol. Its IUPAC name is (2,2,7-trimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate.
| Compound Name | (2,2,7-trimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10829731 |
| Molecular Formula | C12H12F3NO4S |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (2,2,7-trimethyl-1,3-benzoxazin-4-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(c1)OC(C)(C)N=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4S/c1-7-4-5-8-9(6-7)19-11(2,3)16-10(8)20-21(17,18)12(13,14)15/h4-6H,1-3H3 |
| InChIKey | BCLVCRBQVYBTEM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|