About (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate
(9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate (PubChem CID 90225651) has the molecular formula C18H13F3O5S
and a molecular weight of 398.36 g/mol. Its IUPAC name is (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate |
| PubChem CID | 90225651 |
| Molecular Formula | C18H13F3O5S |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2oc3c(c2c1)CCOc1cc(OS(=O)(=O)C(F)(F)F)ccc1-3 |
| InChI | InChI=1S/C18H13F3O5S/c1-10-2-5-15-14(8-10)12-6-7-24-16-9-11(3-4-13(16)17(12)25-15)26-27(22,23)18(19,20)21/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | KEOPETXFIZIWDO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate?
The IUPAC name of (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate (CID 90225651) is (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate.
What is the SMILES notation for (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate?
The canonical SMILES for (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate is Cc1ccc2oc3c(c2c1)CCOc1cc(OS(=O)(=O)C(F)(F)F)ccc1-3.
What is the InChIKey of (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate?
The InChIKey is KEOPETXFIZIWDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3O5S/c1-10-2-5-15-14(8-10)12-6-7-24-16-9-11(3-4-13(16)17(12)25-15)26-27(22,23)18(19,20)21/h2-5,8-9H,6-7H2,1H3.
What are the key properties of (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate?
(9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate has a molecular weight of 398.36 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9-methyl-6,7-dihydro-[1]benzofuro[3,2-d][1]benzoxepin-3-yl) trifluoromethanesulfonate is sourced from PubChem (CID 90225651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).