C11H9F3O5S — CID 155625221
(7-methoxy-2H-chromen-4-yl) trifluoromethanesulfonate (PubChem CID 155625221) has the molecular formula C11H9F3O5S and a molecular weight of 310.25 g/mol. Its IUPAC name is (7-methoxy-2H-chromen-4-yl) trifluoromethanesulfonate.
| Compound Name | (7-methoxy-2H-chromen-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 155625221 |
| Molecular Formula | C11H9F3O5S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | (7-methoxy-2H-chromen-4-yl) trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)OCC=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H9F3O5S/c1-17-7-2-3-8-9(4-5-18-10(8)6-7)19-20(15,16)11(12,13)14/h2-4,6H,5H2,1H3 |
| InChIKey | AAJSPUVDBIKECT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|