C13H11F3O7S — CID 58407116
methyl 7-methoxy-4-(trifluoromethylsulfonyloxy)-2H-chromene-6-carboxylate (PubChem CID 58407116) has the molecular formula C13H11F3O7S and a molecular weight of 368.29 g/mol. Its IUPAC name is methyl 7-methoxy-4-(trifluoromethylsulfonyloxy)-2H-chromene-6-carboxylate.
| Compound Name | methyl 7-methoxy-4-(trifluoromethylsulfonyloxy)-2H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 58407116 |
| Molecular Formula | C13H11F3O7S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | methyl 7-methoxy-4-(trifluoromethylsulfonyloxy)-2H-chromene-6-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1OC)OCC=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O7S/c1-20-10-6-11-7(5-8(10)12(17)21-2)9(3-4-22-11)23-24(18,19)13(14,15)16/h3,5-6H,4H2,1-2H3 |
| InChIKey | ZJAZNVVSJUICLQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|