C23H27F5O7S — CID 161256719
(2-fluoro-5-methoxy-4-propylphenyl) trifluoromethanesulfonate;methyl 2-fluoro-5-methoxy-4-propylbenzoate (PubChem CID 161256719) has the molecular formula C23H27F5O7S and a molecular weight of 542.52 g/mol. Its IUPAC name is (2-fluoro-5-methoxy-4-propylphenyl) trifluoromethanesulfonate;methyl 2-fluoro-5-methoxy-4-propylbenzoate.
| Compound Name | (2-fluoro-5-methoxy-4-propylphenyl) trifluoromethanesulfonate;methyl 2-fluoro-5-methoxy-4-propylbenzoate |
|---|---|
| PubChem CID | 161256719 |
| Molecular Formula | C23H27F5O7S |
| Molecular Weight | 542.52 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | (2-fluoro-5-methoxy-4-propylphenyl) trifluoromethanesulfonate;methyl 2-fluoro-5-methoxy-4-propylbenzoate |
| SMILES | CCCc1cc(F)c(C(=O)OC)cc1OC.CCCc1cc(F)c(OS(=O)(=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C12H15FO3.C11H12F4O4S/c1-4-5-8-6-10(13)9(12(14)16-3)7-11(8)15-2;1-3-4-7-5-8(12)10(6-9(7)18-2)19-20(16,17)11(13,14)15/h6-7H,4-5H2,1-3H3;5-6H,3-4H2,1-2H3 |
| InChIKey | VCACUSOBEPAQAZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|