About (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate
(6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate (PubChem CID 162533143) has the molecular formula C22H15F3O6S
and a molecular weight of 464.42 g/mol. Its IUPAC name is (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate |
| PubChem CID | 162533143 |
| Molecular Formula | C22H15F3O6S |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1)Oc1cc(OS(=O)(=O)C(F)(F)F)ccc1C21OCc2ccccc21 |
| InChI | InChI=1S/C22H15F3O6S/c1-28-14-6-8-17-19(10-14)30-20-11-15(31-32(26,27)22(23,24)25)7-9-18(20)21(17)16-5-3-2-4-13(16)12-29-21/h2-11H,12H2,1H3 |
| InChIKey | QMVSMDQLNFNWSQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate?
The IUPAC name of (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate (CID 162533143) is (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate.
What is the SMILES notation for (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate?
The canonical SMILES for (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate is COc1ccc2c(c1)Oc1cc(OS(=O)(=O)C(F)(F)F)ccc1C21OCc2ccccc21.
What is the InChIKey of (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate?
The InChIKey is QMVSMDQLNFNWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3O6S/c1-28-14-6-8-17-19(10-14)30-20-11-15(31-32(26,27)22(23,24)25)7-9-18(20)21(17)16-5-3-2-4-13(16)12-29-21/h2-11H,12H2,1H3.
What are the key properties of (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate?
(6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate has a molecular weight of 464.42 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6'-methoxyspiro[1H-2-benzofuran-3,9'-xanthene]-3'-yl) trifluoromethanesulfonate is sourced from PubChem (CID 162533143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).