C21H17F3O5S — CID 130289704
(5-cyclopropyl-8-methyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate (PubChem CID 130289704) has the molecular formula C21H17F3O5S and a molecular weight of 438.42 g/mol. Its IUPAC name is (5-cyclopropyl-8-methyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate.
| Compound Name | (5-cyclopropyl-8-methyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130289704 |
| Molecular Formula | C21H17F3O5S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (5-cyclopropyl-8-methyl-5,11-dihydrochromeno[4,3-c]chromen-2-yl) trifluoromethanesulfonate |
| SMILES | Cc1ccc2c(c1)OC(C1CC1)C1=C2COc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C21H17F3O5S/c1-11-2-6-14-16-10-27-17-9-13(29-30(25,26)21(22,23)24)5-7-15(17)19(16)20(12-3-4-12)28-18(14)8-11/h2,5-9,12,20H,3-4,10H2,1H3 |
| InChIKey | TXVQAHXWJYTSNF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|