C27H17Br2F3O4S — CID 88917843
[4-[3,8-dibromo-6-(4-methylphenyl)benzo[c]chromen-6-yl]phenyl] trifluoromethanesulfonate (PubChem CID 88917843) has the molecular formula C27H17Br2F3O4S and a molecular weight of 654.30 g/mol. Its IUPAC name is [4-[3,8-dibromo-6-(4-methylphenyl)benzo[c]chromen-6-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[3,8-dibromo-6-(4-methylphenyl)benzo[c]chromen-6-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88917843 |
| Molecular Formula | C27H17Br2F3O4S |
| Molecular Weight | 654.30 g/mol |
| Exact Mass | 651.92 |
| IUPAC Name | [4-[3,8-dibromo-6-(4-methylphenyl)benzo[c]chromen-6-yl]phenyl] trifluoromethanesulfonate |
| SMILES | Cc1ccc(C2(c3ccc(OS(=O)(=O)C(F)(F)F)cc3)Oc3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C27H17Br2F3O4S/c1-16-2-4-17(5-3-16)26(18-6-10-21(11-7-18)36-37(33,34)27(30,31)32)24-14-19(28)8-12-22(24)23-13-9-20(29)15-25(23)35-26/h2-15H,1H3 |
| InChIKey | ISWVQHSGPSBGKH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.30 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|