About 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene
8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene (PubChem CID 59449412) has the molecular formula C34H35BrO
and a molecular weight of 539.56 g/mol. Its IUPAC name is 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene.
Molecular Properties
| Compound Name | 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene |
| PubChem CID | 59449412 |
| Molecular Formula | C34H35BrO |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene |
| SMILES | Cc1ccc2c(c1)OC(c1ccc(C(C)(C)C)cc1)(c1ccc(C(C)(C)C)cc1)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C34H35BrO/c1-22-8-18-29-28-19-17-27(35)21-30(28)34(36-31(29)20-22,25-13-9-23(10-14-25)32(2,3)4)26-15-11-24(12-16-26)33(5,6)7/h8-21H,1-7H3 |
| InChIKey | ZVPXJRGELSYZPH-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene?
The IUPAC name of 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene (CID 59449412) is 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene.
What is the SMILES notation for 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene?
The canonical SMILES for 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene is Cc1ccc2c(c1)OC(c1ccc(C(C)(C)C)cc1)(c1ccc(C(C)(C)C)cc1)c1cc(Br)ccc1-2.
What is the InChIKey of 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene?
The InChIKey is ZVPXJRGELSYZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H35BrO/c1-22-8-18-29-28-19-17-27(35)21-30(28)34(36-31(29)20-22,25-13-9-23(10-14-25)32(2,3)4)26-15-11-24(12-16-26)33(5,6)7/h8-21H,1-7H3.
What are the key properties of 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene?
8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene has a molecular weight of 539.56 g/mol, XLogP of 9.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6,6-bis(4-tert-butylphenyl)-3-methylbenzo[c]chromene is sourced from PubChem (CID 59449412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).