C68H66Br4O3 — CID 159551451
2,7-dibromo-9,10-bis(4-tert-butylphenyl)phenanthrene-9,10-diol;2,7-dibromo-10,10-bis(4-tert-butylphenyl)phenanthren-9-one (PubChem CID 159551451) has the molecular formula C68H66Br4O3 and a molecular weight of 1250.89 g/mol. Its IUPAC name is 2,7-dibromo-9,10-bis(4-tert-butylphenyl)phenanthrene-9,10-diol;2,7-dibromo-10,10-bis(4-tert-butylphenyl)phenanthren-9-one.
| Compound Name | 2,7-dibromo-9,10-bis(4-tert-butylphenyl)phenanthrene-9,10-diol;2,7-dibromo-10,10-bis(4-tert-butylphenyl)phenanthren-9-one |
|---|---|
| PubChem CID | 159551451 |
| Molecular Formula | C68H66Br4O3 |
| Molecular Weight | 1250.89 g/mol |
| Exact Mass | 1246.17 |
| IUPAC Name | 2,7-dibromo-9,10-bis(4-tert-butylphenyl)phenanthrene-9,10-diol;2,7-dibromo-10,10-bis(4-tert-butylphenyl)phenanthren-9-one |
| SMILES | CC(C)(C)c1ccc(C2(O)c3cc(Br)ccc3-c3ccc(Br)cc3C2(O)c2ccc(C(C)(C)C)cc2)cc1.CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)C(=O)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C34H34Br2O2.C34H32Br2O/c1-31(2,3)21-7-11-23(12-8-21)33(37)29-19-25(35)15-17-27(29)28-18-16-26(36)20-30(28)34(33,38)24-13-9-22(10-14-24)32(4,5)6;1-32(2,3)21-7-11-23(12-8-21)34(24-13-9-22(10-14-24)33(4,5)6)30-20-26(36)16-18-28(30)27-17-15-25(35)19-29(27)31(34)37/h7-20,37-38H,1-6H3;7-20H,1-6H3 |
| InChIKey | MFLDUKFWWWUNOE-UHFFFAOYSA-N |
| XLogP | 18.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1250.89 |
| LogP ≤ 5 | 18.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |