C48H46Br2F6 — CID 88552422
2,8-dibromo-6,6-bis(4-tert-butylphenyl)-12,12-bis(4,4,4-trifluorobutyl)indeno[1,2-b]fluorene (PubChem CID 88552422) has the molecular formula C48H46Br2F6 and a molecular weight of 896.69 g/mol. Its IUPAC name is 2,8-dibromo-6,6-bis(4-tert-butylphenyl)-12,12-bis(4,4,4-trifluorobutyl)indeno[1,2-b]fluorene.
| Compound Name | 2,8-dibromo-6,6-bis(4-tert-butylphenyl)-12,12-bis(4,4,4-trifluorobutyl)indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 88552422 |
| Molecular Formula | C48H46Br2F6 |
| Molecular Weight | 896.69 g/mol |
| Exact Mass | 894.19 |
| IUPAC Name | 2,8-dibromo-6,6-bis(4-tert-butylphenyl)-12,12-bis(4,4,4-trifluorobutyl)indeno[1,2-b]fluorene |
| SMILES | CC(C)(C)c1ccc(C2(c3ccc(C(C)(C)C)cc3)c3cc(Br)ccc3-c3cc4c(cc32)-c2ccc(Br)cc2C4(CCCC(F)(F)F)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C48H46Br2F6/c1-43(2,3)29-9-13-31(14-10-29)48(32-15-11-30(12-16-32)44(4,5)6)41-26-34(50)18-20-36(41)38-27-40-37(28-42(38)48)35-19-17-33(49)25-39(35)45(40,21-7-23-46(51,52)53)22-8-24-47(54,55)56/h9-20,25-28H,7-8,21-24H2,1-6H3 |
| InChIKey | VIRBRZCNDADQOG-UHFFFAOYSA-N |
| XLogP | 15.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.69 |
| LogP ≤ 5 | 15.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |